A6544012
Oxaprozin , ≥98% , 21256-18-8
Synonym(s):
4,5-Diphenyl-2-oxazolepropanoic acid;Daypro;Oxaprozin
CAS NO.:21256-18-8
Empirical Formula: C18H15NO3
Molecular Weight: 293.32
MDL number: MFCD00215977
EINECS: 244-296-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154 °C |
| Boiling point: | 435.17°C (rough estimate) |
| Density | 1.2278 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | solid |
| pka | 4.3(at 25℃) |
| color | Crystals from methanol |
| Water Solubility | 4mg/L(37 ºC) |
| Merck | 14,6924 |
| BCS Class | 2 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21) |
| InChIKey | OFPXSFXSNFPTHF-UHFFFAOYSA-N |
| SMILES | OC(=O)CCc1nc(-c2ccccc2)c(o1)-c3ccccc3 |
| CAS DataBase Reference | 21256-18-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Oxazolepropanoic acid, 4,5-diphenyl- (21256-18-8) |
Description and Uses
Oxaprozin is a non-steroidal antiinflammatory agent indicated for use in various forms of rheumatoid arthritis, osteoarthritis, and ankylosing spondylitis. A long T1/2 allows once/twice daily dosing. Structurally it is somewhat unique, being a 3- substituted, rather than a 2-substituted propionic acid.
antiparasitic
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H413 |
| Precautionary statements | P501-P273 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36/37/39-36-26 |
| WGK Germany | 3 |
| RTECS | RP6990000 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 21256-18-8(Hazardous Substances Data) |
| Toxicity | TDLo orl-rbt: 39 mg/kg (female 6-18D post):TER IYKEDH 15,250,84 |





