A6544312
Ondansetron , ≥99% , 99614-02-5
Synonym(s):
(RS)-1,2,3,9-Tetrahydro-9-methyl-3-(2-methylimidazol-1-ylmethyl)carbazol-4-one;1,2,3,9-Tetrahydro-9-methyl-3-[(2-methyl-1H-imidazol-1-yl)methyl]-4H-carbazol-4-one hydrochloride;GR 38032F
CAS NO.:99614-02-5
Empirical Formula: C18H19N3O
Molecular Weight: 293.36
MDL number: MFCD00764297
EINECS: 619-449-4
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB39.20 | In Stock |
|
| 50MG | RMB55.20 | In Stock |
|
| 1G | RMB69.60 | In Stock |
|
| 250MG | RMB159.20 | In Stock |
|
| 5G | RMB199.20 | In Stock |
|
| 25G | RMB642.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231-232° |
| Boiling point: | 435.21°C (rough estimate) |
| Density | 1.1385 (rough estimate) |
| refractive index | 1.5855 (estimate) |
| storage temp. | −20°C |
| solubility | H2O: >5 mg/mL |
| form | solid |
| pka | pKa 7.4 (Uncertain) |
| color | white |
| InChI | 1S/C18H19N3O/c1-12-19-9-10-21(12)11-13-7-8-16-17(18(13)22)14-5-3-4-6-15(14)20(16)2/h3-6,9-10,13H,7-8,11H2,1-2H3 |
| InChIKey | FELGMEQIXOGIFQ-UHFFFAOYSA-N |
| SMILES | [n]4(c(ncc4)C)CC1CCc2[n](c3c(c2C1=O)cccc3)C |
| CAS DataBase Reference | 99614-02-5(CAS DataBase Reference) |
Description and Uses
Ondansetron (hydrochloride) (CRM) (Item No. 21710) is a certified reference material categorized as an antiemetic. Formulations containing ondansetron have been used to reduce alcohol consumption and mood disturbances in early-onset alcoholics. This product is intended for research and forensic applications.
antibacterial
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H318-H410 |
| Precautionary statements | P264-P273-P280-P301+P310+P330-P305+P351+P338+P310-P391 |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 45-37/39-26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | FE6375500 |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 |
| Hazardous Substances Data | 99614-02-5(Hazardous Substances Data) |
| Toxicity | TDLo vn-man: 229 mg/kg/I LANCAO 344,190,94 |






