A6544912
Orphenadrine Citrate , ≥95% , 4682-36-4
Synonym(s):
β-Dimethylaminoethyl 2-methylbenzhydryl ether citrate salt;o-Methyldiphenhydramine citrate salt;Orphenadrine citrate salt
CAS NO.:4682-36-4
Empirical Formula: C24H31NO8
Molecular Weight: 461.5
MDL number: MFCD00079197
EINECS: 225-137-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB255.20 | In Stock |
|
| 25G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-1340C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Sparingly soluble in water, slightly soluble in ethanol (96 per cent). |
| form | Solid |
| color | White to Pale Beige |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChIKey | ASDBZPGDZBFZAH-UHFFFAOYSA-N |
| SMILES | OC(=O)CC(CC(O)=O)C(O)=O.CN(C)CCOC(c1ccccc1)c2ccccc2C |
| CAS DataBase Reference | 4682-36-4(CAS DataBase Reference) |
Description and Uses
A histaminergic compound
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-40-20/21/22 |
| Safety Statements | 22-36-62-38-36/37/39-28-26-24/25 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2922190900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |





