A6551212
CD437 , ≥98%(HPLC) , 125316-60-1
Synonym(s):
6-(3-(1-Adamantyl)-4-hydroxyphenyl)-2-naphthalene carboxylic acid;6-[3-(1-Adamantyl)-4-hydroxyphenyl]-2-naphthalene carboxylic acid;AHPN;Apoptosis Activator VI, CD437/AHPN - CAS 125316-60-1 - Calbiochem
CAS NO.:125316-60-1
Empirical Formula: C27H26O3
Molecular Weight: 398.49
MDL number: MFCD03106506
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB479.20 | In Stock |
|
| 25MG | RMB1599.20 | In Stock |
|
| 100MG | RMB4479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 271.6-276 °C |
| Boiling point: | 595.0±50.0 °C(Predicted) |
| Density | 1.290 |
| storage temp. | -20°C |
| solubility | DMSO: 26 mg/mL |
| form | solid |
| pka | 4.17±0.30(Predicted) |
| color | yellow |
| InChI | 1S/C27H26O3/c28-25-6-5-22(20-1-2-21-11-23(26(29)30)4-3-19(21)10-20)12-24(25)27-13-16-7-17(14-27)9-18(8-16)15-27/h1-6,10-12,16-18,28H,7-9,13-15H2,(H,29,30) |
| InChIKey | LDGIHZJOIQSHPB-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc2cc(ccc2c1)-c3ccc(O)c(c3)C45CC6CC(CC(C6)C4)C5 |
Description and Uses
An intermediate in the preparation of Adapalene derivatives.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | QJ1975900 |
| Storage Class | 11 - Combustible Solids |







