A6554412
2,3-O-Isopropylidene-alpha,beta-D-ribofuranose , 95% , 13199-25-2
CAS NO.：13199-25-2
Empirical Formula: C8H14O5
Molecular Weight: 190.19
MDL number: MFCD01075718
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB279.20 | In Stock |
|
| 5G | RMB1351.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 127-134 °C(Press: 0.07 Torr) |
| Density | 1.299±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in acetone. |
| pka | 13.46±0.20(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| InChI | InChI=1S/C8H14O5/c1-8(2)12-6(4-10)7(13-8)5(11)3-9/h4-7,9,11H,3H2,1-2H3/t5-,6+,7-/m1/s1 |
| InChIKey | QQMGPCNMYKBXNC-DSYKOEDSSA-N |
| SMILES | O=C[C@H]1[C@@H]([C@@H](CO)O)OC(O1)(C)C |
| CAS DataBase Reference | 13199-25-2(CAS DataBase Reference) |
Description and Uses
2,3-O-Isopropylidene-alpha,beta-D-ribofuranose is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 9999999999 |
