A6562312
Octafluoro-1,4-diiodobutane , 98.0%, containing stabilizer copper crumbs , 375-50-8
CAS NO.:375-50-8
Empirical Formula: C4F8I2
Molecular Weight: 453.84
MDL number: MFCD00042263
EINECS: 206-788-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB119.20 | In Stock |
|
| 5G | RMB423.20 | In Stock |
|
| 25G | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −9 °C(lit.) |
| Boiling point: | 150 °C(lit.) |
| Density | 2.474 g/mL at 25 °C(lit.) |
| vapor pressure | 16hPa at 25℃ |
| refractive index | n |
| Flash point: | 85°C/100mm |
| storage temp. | Refrigerator |
| solubility | Chloroform (Sparingly), Hexane (Slightly) |
| form | Liquid |
| color | Clear colorless to light yellow or pink |
| Water Solubility | 9.3mg/L at 20℃ |
| Sensitive | Light Sensitive |
| BRN | 1777548 |
| Stability: | Stable, but light sensitive. Incompatible with active metals, strong oxidants. |
| InChI | 1S/C4F8I2/c5-1(6,3(9,10)13)2(7,8)4(11,12)14 |
| InChIKey | JILAKKYYZPDQBE-UHFFFAOYSA-N |
| SMILES | FC(F)(I)C(F)(F)C(F)(F)C(F)(F)I |
| LogP | 3.8 |
| CAS DataBase Reference | 375-50-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Butane, 1,1,2,2,3,3,4,4-octafluoro-1,4-diiodo-(375-50-8) |
| EPA Substance Registry System | Perfluoro-1,4-diiodobutane (375-50-8) |
Description and Uses
1,4-Diiodooctafluorobutane is a chain transfer agent, which is used in method for producing fluoropolymer for perfluoroelastomer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | T |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | TOXIC |
| HS Code | 29034980 |
| Storage Class | 10 - Combustible liquids |







