A6198912
Nonafluorobutyl Iodide , 98% , 423-39-2
Synonym(s):
1-Iodoperfluorobutane;Perfluorobutyl iodide
CAS NO.:423-39-2
Empirical Formula: C4F9I
Molecular Weight: 345.93
MDL number: MFCD00001062
EINECS: 207-025-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB96.00 | In Stock |
|
| 100G | RMB325.60 | In Stock |
|
| 500g | RMB1452.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -88 °C |
| Boiling point: | 66-67 °C |
| Density | 2.01 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | None |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| Specific Gravity | 2.010 |
| color | Clear purple |
| Water Solubility | immiscible |
| Sensitive | Light Sensitive |
| BRN | 1777546 |
| Exposure limits | ACGIH: TWA 0.01 ppm |
| Stability: | Stable. Incompatible with bases. |
| InChI | 1S/C4F9I/c5-1(6,3(9,10)11)2(7,8)4(12,13)14 |
| InChIKey | PGRFXXCKHGIFSV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| CAS DataBase Reference | 423-39-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Iodononafluorobutane(423-39-2) |
| EPA Substance Registry System | Butane, 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodo- (423-39-2) |
Description and Uses
Perfluorobutyl iodide (PFBI) is a promising alternative to chlorofluorocarbon solvents used in aircraft ground maintenance operations and other military and commercial operations because it cleans well, has zero ozone depletion potential, and has extremely low global warming properties. Perfluorobutyl iodides also could used as gain media for a solar-pumped laser amplifier. This compound is usually utilized as perfluoroalkyl radical precursors[1–3].
Perfluorobutyl Iodide is used as an organocatalyst in some polymerization reactions.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H411 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | EK5360000 |
| F | 8 |
| Hazard Note | Irritant/Light Sensitive |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29034700 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 |







