A6567112
1,7-Octadiene Diepoxide , >97.0%(GC) , 2426-07-5
Synonym(s):
1,2:7,8-Diepoxyoctane;1,7-Octadiene bisoxide;1,7-Octadiene diepoxide;1,7-Octadiene dioxide;2,2′-(1,4-Butanediyl)bis[oxirane]
CAS NO.：2426-07-5
Empirical Formula: C8H14O2
Molecular Weight: 142.2
MDL number: MFCD00005155
EINECS: 219-375-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB50.40 | In Stock |
|
| 5G | RMB177.60 | In Stock |
|
| 25G | RMB515.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7°C |
| Boiling point: | 240 °C(lit.) |
| Density | 0.997 g/mL at 25 °C(lit.) |
| vapor pressure | <1 hPa ( 20 °C) |
| refractive index | n |
| Flash point: | 208 °F |
| storage temp. | Store below +30°C. |
| solubility | 7g/l |
| form | clear liquid |
| Specific Gravity | 0.991.997 |
| color | Colorless to Light yellow |
| Water Solubility | Soluble in water (partly miscible), acetone and heptane. |
| BRN | 104873 |
| InChI | InChI=1S/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2 |
| InChIKey | LFKLPJRVSHJZPL-UHFFFAOYSA-N |
| SMILES | C(C1CO1)CCCC1CO1 |
| CAS DataBase Reference | 2426-07-5(CAS DataBase Reference) |
| EPA Substance Registry System | Oxirane, 2,2'-(1,4-butanediyl)bis- (2426-07-5) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H311-H341-H350 |
| Precautionary statements | P201-P280-P301+P312+P330-P302+P352+P312-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 22-24-68-45 |
| Safety Statements | 36/37/39-45-53 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | RG9450000 |
| Autoignition Temperature | 350°C (DIN 51794) |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29109000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
