A6570012
<i>o</i>-Toluenesulfonyl Chloride (contains <i>ca</i>. 23% isomer) , >75.0%(GC) , 133-59-5
CAS NO.：133-59-5
Empirical Formula: C7H7ClO2S
Molecular Weight: 190.65
MDL number: MFCD00024874
EINECS: 205-113-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 10°C |
| Boiling point: | 254 °C(lit.) |
| Density | 1.320 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store under inert gas |
| solubility | Acetonitrile (Slightly), Chloroform(Slightly) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | Soluble in hot alcohol, ether and benzene. Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 973180 |
| InChI | InChI=1S/C7H7ClO2S/c1-6-4-2-3-5-7(6)11(8,9)10/h2-5H,1H3 |
| InChIKey | HDECRAPHCDXMIJ-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1C |
| CAS DataBase Reference | 133-59-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 2-methyl- (133-59-5) |
Description and Uses
o-Toluenesulfonyl chloride is used in organic synthesis and saccharin production. It is also used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904100090 |
| Hazardous Substances Data | 133-59-5(Hazardous Substances Data) |
