F828721
Pentamethylbenzenesulfonyl chloride , 98+ , 52499-94-2
CAS NO.:52499-94-2
Empirical Formula: C11H15ClO2S
Molecular Weight: 246.75
MDL number: MFCD00014722
EINECS: 257-968-4
| Pack Size | Price | Stock | Quantity |
| 10g | RMB1311.20 | In Stock |
|
| 50g | RMB3140.80 | In Stock |
|
| 250g | RMB12583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-85 °C(lit.) |
| Boiling point: | 362.5±42.0 °C(Predicted) |
| Density | 1.189±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | crystalline solid |
| color | Off white to dark grey |
| Sensitive | Moisture Sensitive |
| BRN | 2844881 |
| InChI | 1S/C11H15ClO2S/c1-6-7(2)9(4)11(15(12,13)14)10(5)8(6)3/h1-5H3 |
| InChIKey | VDBXRBKVRRJRRW-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)c(c(C)c1C)S(Cl)(=O)=O |
| CAS DataBase Reference | 52499-94-2(CAS DataBase Reference) |
Description and Uses
Pentamethylbenzenesulfonyl chloride is used as a reactant in the preparation of benzosultam derivatives via chlorosulfonylation of benzene derivatives followed by azide substitution and cobalt-porphyrin-catalyzed amination/cyclization.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2930909899 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |







