PRODUCT Properties
| Melting point: | 90-94 °C(lit.) |
| Boiling point: | 89-90 °C(Press: 0.2 Torr) |
| Density | 1.290±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Storage temp. 2-8°C |
| form | Crystalline Powder |
| color | White to yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2640617 |
| InChI | 1S/C8H9ClO2S/c1-6-3-7(2)5-8(4-6)12(9,10)11/h3-5H,1-2H3 |
| InChIKey | LSAGRAXLOLZVKO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 2905-27-3(CAS DataBase Reference) |
Description and Uses
3,5-Dimethylbenzenesulfonyl chloride (dmbSO2Cl) may be used to synthesize hexa-2,4-diyne-1,6-diyl bis(3,5-dimethylbenzenesulfonate) and C2-symmetric ligands, N(SO2R)(CH2Z)2 [where, Z = CH2NH2; R = dmb].
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-39-37-36-A26 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
