PRODUCT Properties
| Melting point: | 118-120 °C(lit.) |
| Boiling point: | 295 °C(lit.) |
| Density | 1.290 |
| storage temp. | 2-8°C |
| Appearance | Off-white to light brown Solid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C8H9ClO2S/c1-6-3-4-8(5-7(6)2)12(9,10)11/h3-5H,1-2H3 |
| InChIKey | DNMQPRPJIWTNAX-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(C)C(C)=C1 |
| CAS DataBase Reference | 2905-30-8(CAS DataBase Reference) |
Description and Uses
3,4-Dimethylbenzenesulfonyl chloride is used as an intermediate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Risk Statements | 34 |
| Safety Statements | 24/25 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
