A6579812
1,1,1,5,5,6,6,6-<WBR>Octafluoro-<WBR>2,4-<WBR>hexanedione , 90% , 20825-07-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB318.40 | In Stock |
|
| 5g | RMB1279.20 | In Stock |
|
| 25g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85-86 °C (lit.) |
| Density | 1.538 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| pka | 4.44±0.10(Predicted) |
| form | liquid |
| color | Clear |
| InChI | 1S/C6H2F8O2/c7-4(8,6(12,13)14)2(15)1-3(16)5(9,10)11/h1H2 |
| InChIKey | MGKBKOFWQWACLM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=O)CC(=O)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 20825-07-4 |
| EPA Substance Registry System | 3H,3H-Perfluoro-2,4-hexanedione (20825-07-4) |
Description and Uses
1,1,1,5,5,6,6,6-Octafluoro-2,4-hexanedione may be used in the extraction of transition metal ions from water into fluorous solvents. It may be used as a chelating agent for chemical vapor deposition (CVD) of barium fluoride thin films.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







