A6622912
Palmityl palmitate , 95% , 540-10-3
Synonym(s):
Cetyl palmitate;Hexadecyl hexadecanoate;Palmitic acid palmityl ester;Palmityl palmitate;Cetyl palmitate 15 (cetylesters wax)
CAS NO.:540-10-3
Empirical Formula: C32H64O2
Molecular Weight: 480.85
MDL number: MFCD00053739
EINECS: 208-736-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB117.60 | In Stock |
|
| 500G | RMB394.40 | In Stock |
|
| 2.5kg | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-56 °C(lit.) |
| Boiling point: | 360 °C |
| Density | d20 0.989 |
| refractive index | 1.4429 (589.3 nm 60℃) |
| storage temp. | 2-8°C |
| solubility | Soluble in hot acetone. |
| form | Crystalline Powder |
| color | White to almost white |
| biological source | synthetic (organic) |
| Merck | 14,2031 |
| Dielectric constant | 2.2(Ambient) |
| InChI | InChI=1S/C32H64O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-32(33)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-31H2,1-2H3 |
| InChIKey | PXDJXZJSCPSGGI-UHFFFAOYSA-N |
| SMILES | C(OCCCCCCCCCCCCCCCC)(=O)CCCCCCCCCCCCCCC |
| LogP | 15.051 (est) |
| CAS DataBase Reference | 540-10-3(CAS DataBase Reference) |
| EPA Substance Registry System | Hexadecyl palmitate (540-10-3) |
Description and Uses
It is used as emollients, masking agents and skin conditioning and a glosser and thickener for creams. It improves emulsion texture and stability and gives structure to cosmetic sticks. Used in skin and hair applications.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | - |
| RTECS | RT4750000 |
| TSCA | Yes |
| HS Code | 29171900 |






