A6624012
Patent blue V sodium salt , 80% , 20262-76-4
CAS NO.：20262-76-4
Empirical Formula: C27H31N2O7S2.Na
Molecular Weight: 582.67
MDL number: MFCD00012119
EINECS: 243-654-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB138.40 | In Stock |
|
| 100G | RMB418.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290 °C (dec.)(lit.) |
| Boiling point: | 300℃[at 101 325 Pa] |
| Density | 1.313[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Crystalline Powder |
| Colour Index | 42051 |
| color | Dark green-blue |
| Water Solubility | 9.46-66.68g/L at 20-25℃ |
| BRN | 4108121 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | PMLFOMWMYRKZRF-UHFFFAOYSA-M |
| SMILES | [Na+].CCN(CC)c1ccc(cc1)\C(=C2/C=CC(\C=C2)=[N+](\CC)CC)c3cc(O)c(cc3S([O-])(=O)=O)S([O-])(=O)=O |
| LogP | -3.62--2.31 at 24-25℃ |
Description and Uses
Patent blue V sodium salt is a pH dependent dye. It can also be used in technical or engineered material use for preparation of metal cation exchanged cellulose as new layer material for identification and separation of organic dyes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | BQ4550000 |
| HS Code | 34021200 |
| Storage Class | 11 - Combustible Solids |
