A6624012
Patent blue V sodium salt , 80% , 20262-76-4
CAS NO.：20262-76-4
Empirical Formula: C27H31N2O7S2.Na
Molecular Weight: 582.67
MDL number: MFCD00012119
EINECS: 243-654-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB138.40 | In Stock |
|
| 100G | RMB418.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290 °C (dec.)(lit.) |
| Boiling point: | 300℃[at 101 325 Pa] |
| Density | 1.313[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Crystalline Powder |
| Colour Index | 42051 |
| color | Dark green-blue |
| Water Solubility | 9.46-66.68g/L at 20-25℃ |
| BRN | 4108121 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | PMLFOMWMYRKZRF-UHFFFAOYSA-M |
| SMILES | [Na+].CCN(CC)c1ccc(cc1)\C(=C2/C=CC(\C=C2)=[N+](\CC)CC)c3cc(O)c(cc3S([O-])(=O)=O)S([O-])(=O)=O |
| LogP | -3.62--2.31 at 24-25℃ |
Description and Uses
lymphangiography and sentinel node biopsy as a dye to color lymph vessels
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | BQ4550000 |
| HS Code | 34021200 |
| Storage Class | 11 - Combustible Solids |
