A6637212
Phloxine B , High -pure level, ≥97.0% , 18472-87-2
Synonym(s):
Acid Red 92;Cyanosine;D&C;Red No. 28;Eosin 10B;2′,4′,5′,7′-Tetrabromo-4,5,6,7-tetrachlorofluorescein disodium salt
CAS NO.：18472-87-2
Empirical Formula: C20H5Br4Cl4NaO5
Molecular Weight: 809.66
MDL number: MFCD00070627
EINECS: 242-355-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB604.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >250°C |
| Density | 0.871[at 20℃] |
| bulk density | 650kg/m3 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Store at RT. |
| solubility | 100g/l |
| form | Powder/Solid |
| Colour Index | 45410 |
| color | Red Brown |
| PH Range | NonQ uorescence (2.5) to yellowish-blue Q uorescence (4.0) |
| PH | 9.7 (1g/l, H2O, 20℃) |
| Water Solubility | water: 1mg/mL, clear, red |
| λmax | 548nm, 510nm |
| BRN | 3887100 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Biological Applications | Detecting proteins; treating microbial infection,parasitic infection,skin,mouth,digestive tract,urinary tract,reproductive tract,respiratory tract,circulatory system,head,neck,endocrine system |
| Major Application | Optical waveguides, color filter, lithographic printing plates, display device, visualization of dentaldevice, inks, highlighters, textiles, hair dyes, cosmetics, visualization of dentalplaque, treatment of infectitious diseases, antitumor agents |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChI | 1S/C20H4Br4Cl4O5.2Na/c21-5-1-3-17(9(23)15(5)29)32-18-4(2-6(22)16(30)10(18)24)20(3)8-7(19(31)33-20)11(25)13(27)14(28)12(8)26;;/h1-2,29-30H;;/q;2*+1/p-2 |
| InChIKey | OOYIOIOOWUGAHD-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]c1c(Br)cc2c(Oc3c(Br)c([O-])c(Br)cc3C24OC(=O)c5c(Cl)c(Cl)c(Cl)c(Cl)c45)c1Br |
| LogP | 0.165 at 25℃ |
| CAS DataBase Reference | 18472-87-2(CAS DataBase Reference) |
| EPA Substance Registry System | Phloxine B (18472-87-2) |
Description and Uses
Phloxine B acts as the sensitizers of dye-sensitized solar cells. Also, it is a fluorescein photoactive dye. Dyes and metabolites, Environmental Testing.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H402 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 2 |
| RTECS | LM5900000 |
| TSCA | TSCA listed |
| HS Code | 32041200 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in Rabbit: 2870 mg/kg |
