A6655412
Pargyline hydrochloride , 99% , 306-07-0
Synonym(s):
N-Methyl-N-(2-propynyl)benzylamine hydrochloride;N-Methyl-N-propargylbenzylamine hydrochloride
CAS NO.:306-07-0
Empirical Formula: C11H14ClN
Molecular Weight: 195.69
MDL number: MFCD00012492
EINECS: 206-175-1
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB88.80 | In Stock |
|
| 1G | RMB357.60 | In Stock |
|
| 5G | RMB1123.20 | In Stock |
|
| 25g | RMB2959.20 | In Stock |
|
| 100g | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-163 °C(lit.) |
| storage temp. | -20°C |
| solubility | ≥33.55 mg/mL in EtOH; ≥51.6 mg/mL in H2O; ≥7.55 mg/mL in DMSO |
| form | A crystalline solid |
| color | Crystals from EtOH/Et2O |
| biological source | synthetic |
| Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow |
| Merck | 13,7110 |
| BRN | 3699487 |
| InChI | InChI=1S/C11H13N.ClH/c1-3-9-12(2)10-11-7-5-4-6-8-11;/h1,4-8H,9-10H2,2H3;1H |
| InChIKey | BCXCABRDBBWWGY-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)CN(C)CC#C.Cl |
| CAS DataBase Reference | 306-07-0 |
Description and Uses
Antihypertensor;Monoamine oxidase inhibitor
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DP6650000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2921199990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 orl-rat: 250 mg/kg 27ZQAG -,401,72 |






