A6662312
Phthalimide potassium salt , >98% , 1074-82-4
Synonym(s):
1,3-Dihydro-1,3-dioxoisoindole potassium salt;Potassium phthalimide;PPI
CAS NO.:1074-82-4
Empirical Formula: C8H4KNO2
Molecular Weight: 185.22
MDL number: MFCD00005887
EINECS: 214-046-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB33.60 | In Stock |
|
| 500G | RMB135.20 | In Stock |
|
| 2.5KG | RMB515.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 366C |
| Density | 1.63 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble50mg/mL, clear to slightly hazy, colorless to yellow |
| form | Crystalline Powder |
| pka | 8.3 (basic)(Solvent: Water) |
| color | White to yellow or greenish |
| PH | pH (50g/l, 25℃) : 10.5~12.5 |
| Water Solubility | Soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 3598719 |
| InChI | InChI=1S/C8H5NO2.K/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H,(H,9,10,11);/q;+1/p-1 |
| InChIKey | FYRHIOVKTDQVFC-UHFFFAOYSA-M |
| SMILES | C12C=CC=CC=1C(N([K])C2=O)=O |
| LogP | -1.859 |
| CAS DataBase Reference | 1074-82-4(CAS DataBase Reference) |
| EPA Substance Registry System | Potassium phthalimide (1074-82-4) |
Description and Uses
Potassium Phthalimide is a green, solid-base organocatalys.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26-60-37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29251995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 1074-82-4(Hazardous Substances Data) |






