A6663212
Phenanthrenequinone , 95% , 84-11-7
Synonym(s):
9,10-Phenanthrenedione;9,10-Phenanthrenequinone
CAS NO.:84-11-7
Empirical Formula: C14H8O2
Molecular Weight: 208.21
MDL number: MFCD00001163
EINECS: 201-515-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB84.80 | In Stock |
|
| 100G | RMB324.00 | In Stock |
|
| 250G | RMB755.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-212 °C(lit.) |
| Boiling point: | 360 °C |
| bulk density | 350kg/m3 |
| Density | 1.405 |
| refractive index | 1.5681 (estimate) |
| Flash point: | 245 °C |
| storage temp. | Store below +30°C. |
| solubility | 7.5mg/l |
| form | Powder |
| color | Orange-brownish |
| Water Solubility | Insoluble in water. |
| λmax | 420 nm |
| Merck | 14,7213 |
| BRN | 608838 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H8O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8H |
| InChIKey | YYVYAPXYZVYDHN-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccccc2-c3ccccc13 |
| CAS DataBase Reference | 84-11-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 9,10-Phenanthroquinone(84-11-7) |
| EPA Substance Registry System | 9,10-Phenanthrenedione (84-11-7) |
Description and Uses
9,10-Phenanthrenequinon may be used for high quality passivation on silicon (100) surfaces. Quinones may serve as substrates for a variety of flavoenzymes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H400 |
| Precautionary statements | P264-P273-P280-P305+P351+P338-P337+P313-P391 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25-22 |
| RIDADR | UN3077 |
| WGK Germany | 3 |
| RTECS | SF7875000 |
| Autoignition Temperature | 630 °C DIN 51794 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 |
| Hazardous Substances Data | 84-11-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: > 16000 mg/kg |





