A6665812
4-(1-Pyrrolidino)benzaldehyde , 97% , 51980-54-2
Synonym(s):
1-(4-Formylphenyl)pyrrolidine
CAS NO.：51980-54-2
Empirical Formula: C11H13NO
Molecular Weight: 175.23
MDL number: MFCD00015469
EINECS: 257-570-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB165.60 | In Stock |
|
| 25G | RMB711.20 | In Stock |
|
| 100g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85 °C |
| Boiling point: | 329.4±25.0 °C(Predicted) |
| Density | 1.125±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 5.68±0.20(Predicted) |
| color | Light yellow to Brown to Dark green |
| Sensitive | Air Sensitive |
| BRN | 135279 |
| InChI | 1S/C11H13NO/c13-9-10-3-5-11(6-4-10)12-7-1-2-8-12/h3-6,9H,1-2,7-8H2 |
| InChIKey | DATXHLPRESKQJK-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(cc1)N2CCCC2 |
| CAS DataBase Reference | 51980-54-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
