[2.2]Paracyclophan , 99% , 1633-22-3
Synonym(s):
Tricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene
CAS NO.:1633-22-3
Empirical Formula: C16H16
Molecular Weight: 208.3
MDL number: MFCD00003707
EINECS: 216-644-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB53.60 | In Stock |
|
| 100G | RMB162.40 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 285-288 °C(lit.) |
| Boiling point: | 282.51°C (rough estimate) |
| Density | 1.0102 (estimate) |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.5000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | INSOLUBLE |
| BRN | 1910888 |
| InChI | InChI=1S/C16H16/c1-2-14-4-3-13(1)9-10-15-5-7-16(8-6-15)12-11-14/h1-8H,9-12H2 |
| InChIKey | OOLUVSIJOMLOCB-UHFFFAOYSA-N |
| SMILES | C12C=CC(=CC=1)CCC1C=CC(=CC=1)CC2 |
| LogP | 5.14 at 20℃ |
| NIST Chemistry Reference | [2.2]Paracyclophane(1633-22-3) |
| EPA Substance Registry System | Tricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene (1633-22-3) |
Description and Uses
[2.2]Paracyclophane is used as an intermediate in organic synthesis or as a reagent in chemical reactions. It serves as the structural backbone of 4-toluenesulfinyl [2.2]p-dicyclohexane and can be used in the synthesis of various mono- and disubstituted [2.2]p-dicyclohexane derivatives. It can also be used for the preparation of metal complexes, and the interaction of the Ag+ cation with the cation -π of [2.2]paracyclophane can be used to synthesise Ag+ - [2.2]paracyclophane complexes using the Ag+ cation. The complex is formed by binding the cation Ag+ to three carbon atoms on a benzene ring of the [2.2]paracyclophane ligand using a cation-π interaction[1].
2,2]-Paracyclophane is the raw material for the synthesis of parylene which is widely used in microelectronic integrated circuit.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,C,F |
| Risk Statements | 11-34 |
| Safety Statements | 24/25-45-36/37/39-26-16 |
| WGK Germany | 3 |
| RTECS | YD2404000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29029080 |
| Storage Class | 11 - Combustible Solids |

![[2.2]Paracyclophan](https://img.chemicalbook.com/CAS/GIF/1633-22-3.gif)

