A6677812
2,6-Pyridinedimethanol , 97% , 1195-59-1
Synonym(s):
2,6-Bis(hydroxymethyl)pyridine
CAS NO.:1195-59-1
Empirical Formula: C7H9NO2
Molecular Weight: 139.15
MDL number: MFCD00006351
EINECS: 214-803-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB392.80 | In Stock |
|
| 100G | RMB1391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C (lit.) |
| Boiling point: | 185°C 15mm |
| Density | 1.1997 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| Flash point: | 185°C/15mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| pka | 13.03±0.10(Predicted) |
| color | Light yellow to beige |
| Water Solubility | Soluble in water. |
| BRN | 116016 |
| InChI | InChI=1S/C7H9NO2/c9-4-6-2-1-3-7(5-10)8-6/h1-3,9-10H,4-5H2 |
| InChIKey | WWFMINHWJYHXHF-UHFFFAOYSA-N |
| SMILES | C1(CO)=NC(CO)=CC=C1 |
| CAS DataBase Reference | 1195-59-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 2,6-dicarbinol(1195-59-1) |
Description and Uses
2,6-Pyridinedimethanol can be used as a quantum dot solution for photoelectric device and biomedicine and also a ligand to synthesize a variety of metal complexes and catalysts.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41-36/37/38 |
| Safety Statements | 26-39-24/25-36 |
| WGK Germany | 3 |
| F | 23 |
| Hazard Note | Irritant |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







