A6681412
Phytic acid solution , 70%inH2O , 83-86-3
Synonym(s):
myo-Inositol hexakis(dihydrogen phosphate)
CAS NO.:83-86-3
Empirical Formula: C6H18O24P6
Molecular Weight: 660.04
MDL number: MFCD00082309
EINECS: 201-506-6
| Pack Size | Price | Stock | Quantity |
| 100G | RMB52.00 | In Stock |
|
| 500G | RMB191.20 | In Stock |
|
| 2.5KG | RMB736.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25℃ |
| Boiling point: | 105 °C |
| Density | 1.432 g/mL at 25 °C |
| vapor pressure | 0.039Pa at 60℃ |
| refractive index | n |
| storage temp. | 2-8°C |
| solubility | Acetone (Slightly), Methanol (Slightly), Water (Soluble) |
| form | Colourless to Light Brown Solution |
| pka | 1.13±0.10(Predicted) |
| Specific Gravity | 1.282 |
| color | Colorless to light yellow |
| Odor | odorless |
| Water Solubility | MISCIBLE |
| Merck | 14,7387 |
| BRN | 2201952 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | CHELATING |
| InChIKey | IMQLKJBTEOYOSI-GPIVLXJGSA-N |
| SMILES | OP(O)(=O)O[C@@H]1[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O |
| CAS DataBase Reference | 83-86-3(CAS DataBase Reference) |
| EPA Substance Registry System | myo-Inositol, hexakis(dihydrogen phosphate) (83-86-3) |
Description and Uses
A compound which inhibits cell differentiation and cell proliferation.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H290-H302-H314 |
| Precautionary statements | P234-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-35 |
| Safety Statements | 26-36-37/39-45-36/37/39 |
| RIDADR | 1760 |
| WGK Germany | - |
| RTECS | NM7525000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29199000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Met. Corr. 1 Skin Corr. 1 |
| Toxicity | LD50 intravenous in mouse: 500mg/kg |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








