S444880
≥96%,mixtureofisomers , 14721-66-5
Synonym(s):
3,7,11,15-Tetramethylhexadecanoic acid;NSC 108698;Phytanoic acid
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1119.22 | In Stock |
|
| 25mg | RMB3422.42 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -65°C |
| Boiling point: | 391.36°C (estimate) |
| Density | 0.8888 (rough estimate) |
| refractive index | 1.4461 (estimate) |
| storage temp. | 2-8°C |
| solubility | 0.15 M Tris-HCl pH 8.5: >1 mg/ml (from Oleic Acid); DMF: >100 mg/ml (from Oleic Acid); DMSO: >100 mg/ml (from Oleic Acid); Ethanol: >100 mg/ml (from Oleic Acid); PBS pH 7.2: <100 μg/ml (from Oleic Acid) |
| pka | 4.79±0.10(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| biological source | synthetic (organic) |
| InChI | 1S/C20H40O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h16-19H,6-15H2,1-5H3,(H,21,22) |
| InChIKey | RLCKHJSFHOZMDR-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(O)=O |
Description and Uses
Phytanic acid is a saturated 20-
Phytanoic Acid was useful for studying lipid metabolism in porcine oocytes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






