A6684912
Poly(1-vinylpyrrolidone-co-vinyl acetate) , 50%inethanol(copolymer,7:3) , 25086-89-9
| Pack Size | Price | Stock | Quantity |
| 100G | RMB53.60 | In Stock |
|
| 500G | RMB194.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.27 g/mL at 25 °C(lit.) |
| Tg | 108 |
| refractive index | 1.4300 to 1.4380 |
| Flash point: | 72 °F |
| solubility | Greater than 10% solubility in 1,4-butanediol, glycerol,
butanol, chloroform, dichloromethane, ethanol (95%),
glycerol, methanol, polyethylene glycol 400, propan-2-ol,
propanol, propylene glycol, and water. Less than 1% solubility
in cyclohexane, diethyl ether, liquid paraffin, and pentane. |
| form | powder |
| color | White |
| Stability: | Stable. Combustible, especially in powdered form. Incompatible with strong oxidising agents, strong reducing agents. |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | BINDING FILM FORMING HAIR FIXING |
| InChI | InChI=1S/C6H9NO.C4H6O2/c1-2-7-5-3-4-6(7)8;1-3-6-4(2)5/h2H,1,3-5H2;3H,1H2,2H3 |
| InChIKey | FYUWIEKAVLOHSE-UHFFFAOYSA-N |
| SMILES | C(N1CCCC1=O)=C.O(C=C)C(=O)C |
| LogP | 0.370 (est) |
| EPA Substance Registry System | Vinyl acetate N-vinyl-pyrrolidone polymer (25086-89-9) |
Description and Uses
Copovidone is a water-soluble polymer used to improve the uptake and drug loading of various pharmaceutical agents, including contraceptive patches.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P261-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38-67-36-11-22 |
| Safety Statements | 22-24/25-36/37/39-26-16 |
| RIDADR | UN 1987 3/PG 2 |
| WGK Germany | 1 |
| RTECS | AH3539000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orl-rat: >630 mg/kg JACTDZ 2(5),141,83 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




