A6692512
Pendimethaline , Analysis standard product, 99% , 40487-42-1
CAS NO.:40487-42-1
Empirical Formula: C13H19N3O4
Molecular Weight: 281.31
MDL number: MFCD00055332
EINECS: 254-938-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB295.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-57°C |
| Boiling point: | 330°C |
| Density | 1.17 |
| refractive index | 1.5700 (estimate) |
| Flash point: | 11 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO: 100 mg/mL (355.48 mM) |
| pka | -2.24±0.33(Predicted) |
| form | Solid |
| color | Yellow-orange brown |
| Water Solubility | <0.5 mg/L |
| Merck | 14,7084 |
| BRN | 2157711 |
| Major Application | agriculture |
| InChI | 1S/C13H19N3O4/c1-5-10(6-2)14-12-11(15(17)18)7-8(3)9(4)13(12)16(19)20/h7,10,14H,5-6H2,1-4H3 |
| InChIKey | CHIFOSRWCNZCFN-UHFFFAOYSA-N |
| SMILES | CCC(CC)Nc1c(cc(C)c(C)c1[N+]([O-])=O)[N+]([O-])=O |
| LogP | 5.180 |
| NIST Chemistry Reference | Penoxaline(40487-42-1) |
| EPA Substance Registry System | Pendimethalin (40487-42-1) |
Description and Uses
Herbicide used to control the spread of weedgrass.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H410 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352 |
| target organs | Eyes,Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi;N,N,Xi,T,F |
| Risk Statements | 43-50/53-39/23/24/25-23/24/25-11 |
| Safety Statements | 2-24-29-37-60-61-45-16-7-36/37 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | BX5470000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Hazardous Substances Data | 40487-42-1(Hazardous Substances Data) |
| Toxicity | LC50 (96-hour) for rainbow trout 138 μg/L and bluegill sunfish 199 μg/L; acute oral LD50 of the technical product for male and female rats 1,250 and 1,050 mg/kg, respectively (Ashton and Monaco, 1991) |





