Polydatin , ≥95%(HPLC) , 27208-80-6
Synonym(s):
trans-3,4′,5-Trihydroxystilbene 3-O-β-D -glucoside;trans-Piceid;trans-Resveratrol 3-O-β-D -glucoside
| Pack Size | Price | Stock | Quantity |
| 1G | RMB49.60 | In Stock |
|
| 5G | RMB112.80 | In Stock |
|
| 25G | RMB365.60 | In Stock |
|
| 100G | RMB1272.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 223-226 °C(lit.) |
| alpha | -77.5 º (c=0.2, EtOH) |
| Boiling point: | 707.7±60.0 °C(Predicted) |
| Density | 1.521±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO, Ethanol, Methanol |
| pka | 9.21±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| λmax | 305nm(EtOH)(lit.) |
| InChI | InChI=1/C20H22O8/c21-10-16-17(24)18(25)19(26)20(28-16)27-15-8-12(7-14(23)9-15)2-1-11-3-5-13(22)6-4-11/h1-9,16-26H,10H2/b2-1+/t16-,17-,18+,19-,20-/s3 |
| InChIKey | HSTZMXCBWJGKHG-RPHGGTSJNA-N |
| SMILES | O(C1C=C(O)C=C(/C=C/C2C=CC(O)=CC=2)C=1)[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O |&1:17,18,19,21,23,r| |
| LogP | 0.412 (est) |
| CAS DataBase Reference | 27208-80-6(CAS DataBase Reference) |
Description and Uses
Polydatin is a stilbene glucoside and a precursor to trans-resveratrol (Item No. 70675) that has been found in V. vinifera and has diverse biological activities. It scavenges DPPH radicals and inhibits copper-induced lipid peroxidation (IC50s = 198 and 19.1 μM, respectively). Polydatin inhibits the proliferation of, and induces cell cycle arrest at the S phase in, Caco-2 colon cancer cells. It decreases infarct size, cardiomyocyte fibrosis, and apoptosis in a mouse model of myocardial ischemia-reperfusion injury induced by left anterior descending (LAD) coronary artery occlusion when administered at a dose of 40 mg/kg per day.
antioxidant
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29389090 |
