A6693012
Promecarb , Analysis of standard products, 98.5% , 2631-37-0
CAS NO.：2631-37-0
Empirical Formula: C12H17NO2
Molecular Weight: 207.27
MDL number: MFCD00078728
EINECS: 220-113-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87.5℃ |
| Boiling point: | 117℃ (10-12 Torr) |
| Density | 1.0681 (rough estimate) |
| refractive index | 1.5220 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 12.37±0.46(Predicted) |
| form | Crystalline |
| color | White to Off-White |
| Water Solubility | 92mg/L(room temperature) |
| Merck | 13,7875 |
| BRN | 2111695 |
| InChI | 1S/C12H17NO2/c1-8(2)10-5-9(3)6-11(7-10)15-12(14)13-4/h5-8H,1-4H3,(H,13,14) |
| InChIKey | DTAPQAJKAFRNJB-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc(C)cc(c1)C(C)C |
| CAS DataBase Reference | 2631-37-0(CAS DataBase Reference) |
| EPA Substance Registry System | Promecarb (2631-37-0) |
Description and Uses
Insecticide.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H311-H410 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312 |
| Hazard Codes | T,N |
| Risk Statements | 25-50/53 |
| Safety Statements | 24-37-45-60-61 |
| RIDADR | 2757 |
| WGK Germany | 3 |
| RTECS | FB8050000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Acute Tox. 3 Dermal Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 2631-37-0(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (mg/kg): 39.5, 60 orally (Miyao) |
