A6693212
Prochloraz solution , analyticalstandard,100ug/mlintoluene , 67747-09-5
CAS NO.:67747-09-5
Empirical Formula: C15H16Cl3N3O2
Molecular Weight: 376.67
MDL number: MFCD00078735
EINECS: 266-994-5
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB95.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-49°C |
| Boiling point: | 360℃ |
| Density | 1.405 |
| vapor pressure | 1.5 x l0-4 Pa (25 °C) |
| refractive index | 1.6490 (estimate) |
| Flash point: | 2 °C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS(pH 7.2) (1:1): 0.5 mg/ml |
| pka | 3.8 (weak base) |
| Water Solubility | 34.4 mg l-1 (25 °C) |
| form | Solid |
| color | White to Light yellow to Light orange |
| Merck | 14,7760 |
| BRN | 8155344 |
| Major Application | agriculture environmental |
| InChI | 1S/C15H16Cl3N3O2/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18/h3,5,8-10H,2,4,6-7H2,1H3 |
| InChIKey | TVLSRXXIMLFWEO-UHFFFAOYSA-N |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n2ccnc2 |
| LogP | 4.100 |
| CAS DataBase Reference | 67747-09-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Prochloraz(67747-09-5) |
| EPA Substance Registry System | Prochloraz (67747-09-5) |
Description and Uses
Plocloraz is used as a fungicide. Plocloraz showed efficacy against cereal powdery mildew.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn;N,N,Xn,F |
| Risk Statements | 22-50/53-36-20/21/22-11 |
| Safety Statements | 60-61-36/37-26 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | NI4000400 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity | LD50 in rats (mg/kg): 1600 orally; >5000 s.c.; 400-800 i.p.; LC50 (96 hour) in rainbow trout, bluegill (mg/l): 1, 2.2 (de Saint-Blanquat, My) |



