A6693812
4-Piperidinopiperidine , 98% , 4897-50-1
Synonym(s):
1,4′-Bipiperidine
CAS NO.:4897-50-1
Empirical Formula: C10H20N2
Molecular Weight: 168.28
MDL number: MFCD00006475
EINECS: 225-522-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB42.40 | In Stock |
|
| 5G | RMB108.00 | In Stock |
|
| 25G | RMB407.20 | In Stock |
|
| 100G | RMB1191.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66 °C (lit.) |
| Boiling point: | 287.25°C (rough estimate) |
| Density | 0.9725 (rough estimate) |
| refractive index | 1.6011 (estimate) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 10.31±0.10(Predicted) |
| form | Crystalline Solid |
| color | Light yellow to yellow-brown |
| InChI | InChI=1S/C10H20N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10/h10-11H,1-9H2 |
| InChIKey | QDVBKXJMLILLLB-UHFFFAOYSA-N |
| SMILES | N1(C2CCNCC2)CCCCC1 |
| CAS DataBase Reference | 4897-50-1(CAS DataBase Reference) |
Description and Uses
Reactant for synthesis of:
Arylthiadiazole H3 antagonists
Water-soluble N-mustards as anticancer agents
Antitubercular drugs
Vasopressin1b receptor antagonists
MDR modulators
Selective Norepinephrine transporter inhibitors
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | 8 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![(S)-4,8,11-Triethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14-(4H,12H)-dione](https://img.chemicalbook.com/CAS/GIF/947687-01-6.gif)
