A6700312
Pyridoxal 5-Phosphate Monohydrate , 98% , 41468-25-1
Synonym(s):
PLP;Pyridoxal phosphate;Pyridoxal 5-phosphate;P5P;Peroxiredoxin 5
CAS NO.:41468-25-1
Empirical Formula: C8H12NO7P
Molecular Weight: 265.16
MDL number: MFCD00149414
EINECS: 609-929-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 25G | RMB298.40 | In Stock |
|
| 100G | RMB697.60 | In Stock |
|
| 500g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-143 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), DMSO (Slightly) |
| form | Crystalline Powder |
| color | Pale yellow |
| biological source | synthetic |
| Water Solubility | 5 g/L (20 ºC) |
| Sensitive | Light Sensitive |
| Merck | 14,7979 |
| BRN | 234749 |
| Stability: | Air Sensitive, Moisture Sensitive |
| Major Application | cell analysis |
| InChI | InChI=1S/C8H10NO6P.H2O/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;/h2-3,11H,4H2,1H3,(H2,12,13,14);1H2 |
| InChIKey | CEEQUQSGVRRXQI-UHFFFAOYSA-N |
| SMILES | C1(COP(=O)(O)O)=CN=C(C)C(O)=C1C=O.O |
| CAS DataBase Reference | 41468-25-1(CAS DataBase Reference) |
Description and Uses
Pyridoxal 5'-phosphate monohydrate is a water-soluble form of Pyridoxal 5′-phosphate (PLP), which can be used to synthesise the drug MC-1, a cardioprotective agent designed to reduce damage to the heart when arteries are blocked and subsequently reopened after bypass surgery. It is also widely used to cure the Parkinson's disease clinically.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 2 |
| RTECS | UV1208000 |
| F | 8-10-23 |
| TSCA | Yes |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |






