A6842612
Pyridoxal 5′-phosphate hydrate , ≥98% , 853645-22-4
CAS NO.：853645-22-4
Empirical Formula: C8H10NO6P
Molecular Weight: 247.14
MDL number: MFCD00006333
EINECS: 200-208-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB1929.60 | In Stock |
|
| 100g | RMB5400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-143 ºC |
| storage temp. | -20°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly), Water (Slightly) |
| pka | pKa 8.69(H2O
t = 25
I = 0.15)(Approximate) |
| form | powder |
| color | White to Pale Yellow |
| Odor | Odorless |
| biological source | synthetic (organic) |
| BRN | 234749 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H10NO6P/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h2-3,11H,4H2,1H3,(H2,12,13,14) |
| InChIKey | NGVDGCNFYWLIFO-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(COP(O)(O)=O)C(C=O)=C1O |
Description and Uses
Enzyme cofactor.Normal coenzyme form of Vitamin B6
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
