A6735212
4-Phenoxyaniline , 98% , 139-59-3
Synonym(s):
4-Aminophenyl phenyl ether
CAS NO.:139-59-3
Empirical Formula: C12H11NO
Molecular Weight: 185.22
MDL number: MFCD00007862
EINECS: 205-367-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB131.20 | In Stock |
|
| 100G | RMB286.40 | In Stock |
|
| 500G | RMB1350.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84 °C(lit.) |
| Boiling point: | 140 °C (2.2503 mmHg) |
| Density | 1.0936 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | RT, protect from light |
| pka | 4.75±0.10(Predicted) |
| form | Crystalline Flakes or Powder |
| color | Brown to green-brown |
| Water Solubility | < 1 g/L (20 ºC) |
| BRN | 777708 |
| InChI | InChI=1S/C12H11NO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H,13H2 |
| InChIKey | WOYZXEVUWXQVNV-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 139-59-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-phenoxy-(139-59-3) |
| EPA Substance Registry System | Benzenamine, 4-phenoxy- (139-59-3) |
Description and Uses
4-Phenoxyaniline is used as a dye intermediate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS06,GHS08,GHS09,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H301-H341-H400-H410 |
| Precautionary statements | P261-P280-P305+P351+P338-P201-P301+P310a-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-43-68-50/53 |
| Safety Statements | 26-36/37/39-61-45-24 |
| WGK Germany | 3 |
| RTECS | BY7930000 |
| F | 9 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity | skn-rbt 500 mg/24H MLD 28ZPAK -,119,72 |







![Bis[4-(4-aminophenoxy)phenyl] Sulfone](https://img.chemicalbook.com/CAS/GIF/13080-89-2.gif)

