A6744512
Potassium biphthalate Buffer tablets pH 4.0 , PH standard value: 4 , 877-24-7
Synonym(s):
Potassium hydrogen phthalate;KHP;Potassium biphthalate;buffer solution;Potassium phthalate monobasic
CAS NO.:877-24-7
Empirical Formula: C8H5KO4
Molecular Weight: 204.22
MDL number: MFCD00146206
EINECS: 212-889-4
| Pack Size | Price | Stock | Quantity |
| 10×2g | RMB79.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 295-300 °C (dec.) (lit.) |
| Boiling point: | 98.5-99.5 ;°C/740 ;mmHg(lit .) |
| Density | 1.006 g/mL at 20 °C |
| bulk density | 900kg/m3 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: 100 mg/mL, clear, colorless |
| form | Solid |
| color | White |
| PH | 4.00-4.02 (25.0℃±0.2℃, 0.05M) |
| Odor | Odorless |
| PH Range | 3.8 - 4.0 (5% aq. sol.) |
| Water Solubility | 80 G/L (20 ºC) |
| Merck | 14,7612 |
| BRN | 3637128 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | 1S/C8H6O4.K/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| SMILES | [K+].OC(=O)c1ccccc1C([O-])=O |
| LogP | -2.73 |
| CAS DataBase Reference | 877-24-7(CAS DataBase Reference) |
| EPA Substance Registry System | Monopotassium phthalate (877-24-7) |
| Absorption | cut-off at 309nm in H2O at 0.1M |
Description and Uses
Potassium hydrogen phthalate [KHP; pH(S) = 4.005 (25 °C)] is a certified secondary standard reference material used as a calibration buffer standard for pH instruments or pH electrodes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi,C,T |
| Risk Statements | 36/38-36/37/38-34-61-60 |
| Safety Statements | 26-36-24/25-22-45-36/37/39-53 |
| RIDADR | UN 1789 8/PG 3 |
| WGK Germany | 1 |
| RTECS | CZ4326000 |
| F | 34 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 13 - Non Combustible Solids |
| Toxicity | LD50 orally in Rabbit: > 3200 mg/kg |





