A6748512
Potassium oleate , 98% , 143-18-0
Synonym(s):
Oleic acid potassium salt
CAS NO.：143-18-0
Empirical Formula: C18H33KO2
Molecular Weight: 320.55
MDL number: MFCD00064243
EINECS: 205-590-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB32.80 | In Stock |
|
| 500G | RMB147.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | >1.1 g/cm3 |
| Flash point: | 140 °C |
| storage temp. | 2-8°C |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | Pale white powder |
| Merck | 14,7650 |
| BRN | 4167152 |
| Hydrophilic-Lipophilic Balance (HLB) | 20 |
| InChI | InChI=1S/C18H34O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b10-9-; |
| InChIKey | MLICVSDCCDDWMD-KVVVOXFISA-M |
| SMILES | C(CCCCCC([O-])=O)C/C=C\CCCCCCCC.[K+] |
| LogP | 3.920 (est) |
| CAS DataBase Reference | 143-18-0(CAS DataBase Reference) |
| EPA Substance Registry System | Potassium oleate (143-18-0) |
Description and Uses
Potassium Oleate can be used as a compound disinfectant.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | RK1150000 |
| HS Code | 2916.15.5100 |
| Hazardous Substances Data | 143-18-0(Hazardous Substances Data) |
| Toxicity | eye-rbt 12 mg/48H JANCA2 56,905,73 |
