A7270912
Sodium oleate , CP , 143-19-1
Synonym(s):
cis-9-Octadecenoic acid sodium salt;Oleic acid sodium salt
CAS NO.：143-19-1
Empirical Formula: C18H33NaO2
Molecular Weight: 304.44
MDL number: MFCD00004438
EINECS: 205-591-0
| Pack Size | Price | Stock | Quantity |
| 100g | RMB472.00 | In Stock |
|
| 250G | RMB607.20 | In Stock |
|
| 1KG | RMB2079.20 | In Stock |
|
| 5KG | RMB9360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-235 °C (lit.) |
| storage temp. | -20°C |
| solubility | Methanol (Slightly) |
| form | Powder |
| color | White to slightly yellow |
| Odor | slt tallow odor |
| biological source | synthetic (organic) |
| Water Solubility | soluble H2O, partially decomposes; soluble alcohol [HAW93] |
| Merck | 14,6828 |
| BRN | 4046357 |
| Hydrophilic-Lipophilic Balance (HLB) | 18 |
| Dielectric constant | 2.7（20℃） |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C18H34O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b10-9-; |
| InChIKey | BCKXLBQYZLBQEK-KVVVOXFISA-M |
| SMILES | C(CCCCCC([O-])=O)C/C=C\CCCCCCCC.[Na+] |
| LogP | 7.698 (est) |
| CAS DataBase Reference | 143-19-1(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium oleate (143-19-1) |
Description and Uses
Sodium Oleate is the sodium salt of oleic acid. it functions as a binder, emulsifier, and anticaking agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H412 |
| Precautionary statements | P501-P273 |
| Safety Statements | 22-24/25-25-24 |
| WGK Germany | 1 |
| RTECS | RK1200000 |
| F | 10-23 |
| HS Code | 29161500 |
| Hazardous Substances Data | 143-19-1(Hazardous Substances Data) |
| Toxicity | LD50 ivn-mus: 152 mg/kg RPOBAR 2,327,70 |
