A6755312
O-Phenyl chlorothionoformate , 98% , 1005-56-7
Synonym(s):
Phenyl thionochloroformate
CAS NO.:1005-56-7
Empirical Formula: C7H5ClOS
Molecular Weight: 172.63
MDL number: MFCD00004920
EINECS: 213-736-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB94.40 | In Stock |
|
| 25G | RMB430.40 | In Stock |
|
| 100G | RMB1583.20 | In Stock |
|
| 500g | RMB5860.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51 °C |
| Boiling point: | 81-83 °C/6 mmHg (lit.) |
| Density | 1.248 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 179 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Liquid |
| Specific Gravity | 1.248 |
| color | Clear yellow |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 774830 |
| InChI | InChI=1S/C7H5ClOS/c8-7(10)9-6-4-2-1-3-5-6/h1-5H |
| InChIKey | KOSYAAIZOGNATQ-UHFFFAOYSA-N |
| SMILES | C(Cl)(=S)OC1=CC=CC=C1 |
| CAS DataBase Reference | 1005-56-7(CAS DataBase Reference) |
Description and Uses
O-Phenyl chlorothionoformate has been used in:
- stereodirected synthesis of optically active, (?)-mintlactone
- synthesis of peptide α-thioesters having a variety of C-terminal amino acids
- synthesis of scyllo-inositol derivatives
- thionocarbonylation of unprotected thymine nucleosides
- preparation of phenoxythiocarbonyl esters of protected ribonucleosides
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29309070 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







