PRODUCT Properties
| Melting point: | 96 °C |
| Boiling point: | 130 °C / 10mmHg |
| Density | 1.1155 (rough estimate) |
| refractive index | 1.6550 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Acetone |
| form | powder |
| pka | 4.71±0.30(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C15H11N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-11H |
| InChIKey | LPCWDYWZIWDTCV-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)C2=C(C=CC=C2)C=CN=1 |
| CAS DataBase Reference | 3297-72-1 |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| WGK Germany | 3 |
| HS Code | 29334900 |
