A6760912
n-Propylboronic acid , 98% , 17745-45-8
CAS NO.：17745-45-8
Empirical Formula: C3H9BO2
Molecular Weight: 87.91
MDL number: MFCD01074564
EINECS: 681-581-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB340.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-108°C |
| Boiling point: | 170.8±23.0 °C(Predicted) |
| Density | 0.925±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 10.31±0.43(Predicted) |
| form | Crystalline Powder or Flakes |
| color | White to off-white |
| Sensitive | Air Sensitive |
| BRN | 1731884 |
| InChI | InChI=1S/C3H9BO2/c1-3(2)4(5)6/h3,5-6H,1-2H3 |
| InChIKey | QIPHSSYCQCBJAX-UHFFFAOYSA-N |
| SMILES | CC(B(O)O)C |
| CAS DataBase Reference | 17745-45-8(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
