A6520012
(±)-Octopamine hydrochloride , 98% , 770-05-8
Synonym(s):
α-(Aminomethyl)-4-hydroxybenzyl alcohol hydrochloride;(±)-1-(4-Hydroxyphenyl)-2-amino-ethanol hydrochloride
CAS NO.:770-05-8
Empirical Formula: C8H12ClNO2
Molecular Weight: 189.64
MDL number: MFCD00012881
EINECS: 212-216-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25g | RMB221.60 | In Stock |
|
| 100g | RMB516.80 | In Stock |
|
| 500g | RMB1932.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~170 °C (dec.)(lit.) |
| Boiling point: | 290℃[at 101 325 Pa] |
| Density | 1.39[at 20℃] |
| vapor pressure | 0.002Pa at 20℃ |
| storage temp. | 2-8°C |
| solubility | H2O: soluble |
| form | solid |
| color | white or off-white |
| Water Solubility | soluble |
| Merck | 13,6791 |
| BRN | 3915414 |
| Stability: | Stable. |
| InChI | InChI=1S/C8H11NO2.ClH/c9-5-8(11)6-1-3-7(10)4-2-6;/h1-4,8,10-11H,5,9H2;1H |
| InChIKey | PUMZXCBVHLCWQG-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(=CC=1)O)(O)CN.Cl |
| LogP | -2.6 at 20.1℃ |
| CAS DataBase Reference | 770-05-8(CAS DataBase Reference) |
Description and Uses
Octopamine HCL has the ability to halt catabolism of proteinaceous tissues. It is very important while losing weight to maximize adipose loss while minimizing the loss of muscle and other lean body tissue. Octopamine Hcl (norepinephrine) is best known as an effective ephedrine alternative, claiming to boost energy while reduce weight in bodybuilding industry for weight loss purpose. In addition, many users believe octopamine hcl is a good nootropic compound that makes our brain easy to focus, enhances motivation as a wakefulness promoter.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P280 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36-37/39-26 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |






