A1184612
Butylboronic acid (contains varying amounts of Anhydride) , 98% , 4426-47-5
Synonym(s):
1-Butaneboronic acid
CAS NO.：4426-47-5
Empirical Formula: C4H11BO2
Molecular Weight: 101.94
MDL number: MFCD00002106
EINECS: 224-607-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB255.20 | In Stock |
|
| 100g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C(lit.) |
| Boiling point: | 189.2±23.0 °C(Predicted) |
| Density | 1.022 g/cm3 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 10.37±0.43(Predicted) |
| color | Clear colorless to slightly yellow |
| Water Solubility | ca 2.5 g/100 mL |
| Sensitive | Air Sensitive & Hygroscopic |
| BRN | 1733489 |
| InChI | InChI=1S/C4H11BO2/c1-3-4(2)5(6)7/h4,6-7H,3H2,1-2H3 |
| InChIKey | QPKFVRWIISEVCW-UHFFFAOYSA-N |
| SMILES | CC(B(O)O)CC |
| CAS DataBase Reference | 4426-47-5(CAS DataBase Reference) |
Description and Uses
n-Butylboronic acid is a boronic acid derivative that can be used as a transport carriers in membrane-based sugar separations. n-Butylboronic acid is used as an analytical reagent in the determination of serum glucose.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| F | 3-10-23 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
