A6764712
Phenol-d6 , 98atom%D , 13127-88-3
Synonym(s):
Hexadeuterophenol;Pentadeuteriophenol
CAS NO.:13127-88-3
Empirical Formula: C6D6O
Molecular Weight: 100.15
MDL number: MFCD00084164
EINECS: 236-063-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB319.20 | In Stock |
|
| 1G | RMB870.40 | In Stock |
|
| 5G | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42 °C (lit.) |
| Boiling point: | 182 °C (lit.) |
| Density | 1.140 g/mL at 25 °C |
| vapor density | 3.24 (vs air) |
| vapor pressure | 0.36 mm Hg ( 20 °C) |
| Flash point: | 175 °F |
| storage temp. | 2-8°C |
| solubility | 84g/l |
| form | Solid Mass (Deliquescent) |
| PH | 5 (50g/l, H2O, 20℃) |
| explosive limit | 1.3-9.5%(V) |
| BRN | 2255089 |
| Stability: | Stable. Incompatible with strong acids, strong bases, strong oxidizing agents. |
| InChI | 1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H/i1D,2D,3D,4D,5D/hD |
| InChIKey | ISWSIDIOOBJBQZ-QNKSCLMFSA-N |
| SMILES | [2H]Oc1c([2H])c([2H])c([2H])c([2H])c1[2H] |
| CAS DataBase Reference | 13127-88-3(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol-d6 (13127-88-3) |
| CAS Number Unlabeled | 108-95-2 |
Description and Uses
Phenol is purified here for molecular genetics applications. It is naturally found in tea leaves and plants, and has uses in the synthesis of antioxidant compounds due to the antioxidant activity caus ed by the phenol moiety. This structure also allows it to be used for syntheses of anti-bacterial & anti-carcinogenic compounds. This is the labelled analog.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H314-H341-H373-H411 |
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Nervous system,Kidney,Liver,Skin |
| Hazard Codes | T,C,Xn |
| Risk Statements | 23/24/25-34-48/20/21/22-68-40 |
| Safety Statements | 24/25-26-28-36/37/39-45-36/37 |
| RIDADR | UN 1671 6.1/PG 2 |
| WGK Germany | 2 |
| F | 3-8-10-23 |
| Autoignition Temperature | 1319 °F |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 Eye Dam. 1 Muta. 2 Skin Corr. 1B STOT RE 2 |








