PRODUCT Properties
| Boiling point: | 674.4±55.0 °C(Predicted) |
| Density | 1.193±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| pka | 3.48±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | 1S/C23H28N2O5/c1-16(2)13-20(22(27)28)24-21(26)19(14-17-9-5-3-6-10-17)25-23(29)30-15-18-11-7-4-8-12-18/h3-12,16,19-20H,13-15H2,1-2H3,(H,24,26)(H,25,29)(H,27,28) |
| InChIKey | IBOXOGVHBFUSFH-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)OCc2ccccc2)C(O)=O |
Description and Uses
Substrate for carboxypeptidase Y.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
