A6771312
1H,1H,2H,2H-Perfluorodecyltriethoxysilane , 96% , 101947-16-4
Synonym(s):
Triethoxy-1H,1H,2H,2H-perfluorodecylsilane
CAS NO.:101947-16-4
Empirical Formula: C16H19F17O3Si
Molecular Weight: 610.38
MDL number: MFCD00042334
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB120.80 | In Stock |
|
| 25G | RMB402.40 | In Stock |
|
| 100G | RMB1470.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 209-230 °C |
| Density | 1.389 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Miscible with ethanol and tetrahydrofuran. |
| form | liquid |
| Specific Gravity | 1.41 |
| color | Colourless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| Cosmetics Ingredients Functions | ANTICAKING |
| InChI | InChI=1S/C16H19F17O3Si/c1-4-34-37(35-5-2,36-6-3)8-7-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h4-8H2,1-3H3 |
| InChIKey | MLXDKRSDUJLNAB-UHFFFAOYSA-N |
| SMILES | [Si](OCC)(OCC)(OCC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 101947-16-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane (101947-16-4) |
Description and Uses
1H,1H,2H,2H-Perfluorodecyltriethoxysilane, also named perfluoroalkylethyltrimethoxysilane (PFATES), is used to bond poly(tetrafluoroethylene) films to silicon wafers and it is also utilized in anti-reflective coating, release coating and soil repellent coating because of its special chemical structure. It can be used as an anti-fingerprint agent for glass products such as advanced mobile phone screens and camera lenses.
1H,1H,2H,2H-Perfluorodecyltriethoxysilane is used in making thin film transistors, polyethersulfone membranes, and a superwettable Janus membrane.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P201-P202-P263-P301+P312-P304+P340+P312-P308+P313 |
| target organs | Liver |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1760 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | No |
| HazardClass | 8 |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |








