A6781312
4-Phenyl-1,2,4-triazoline-3,5-dione , 97% , 4233-33-4
Synonym(s):
4-Phenyl-3,5-dihydro-4H-1,2,4-triazole-3,5-dione, PTAD;4-Phenyl-3H-1,2,4-triazole-3,5(4H)-dione;Cookson reagent;PTAD
CAS NO.:4233-33-4
Empirical Formula: C8H5N3O2
Molecular Weight: 175.14
MDL number: MFCD00003148
EINECS: 224-191-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB47.20 | In Stock |
|
| 1G | RMB94.40 | In Stock |
|
| 5G | RMB387.20 | In Stock |
|
| 25g | RMB1648.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-170 °C (dec.)(lit.) |
| Boiling point: | 263.8±23.0 °C(Predicted) |
| Density | 1.47±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -1.71±0.20(Predicted) |
| color | Red to Dark Red |
| BRN | 141548 |
| InChI | InChI=1S/C8H5N3O2/c12-7-9-10-8(13)11(7)6-4-2-1-3-5-6/h1-5H |
| InChIKey | ISULLEUFOQSBGY-UHFFFAOYSA-N |
| SMILES | N1C(=O)N(C2=CC=CC=C2)C(=O)N=1 |
| CAS DataBase Reference | 4233-33-4(CAS DataBase Reference) |
Description and Uses
4-PHENYL-1,2,4-TRIAZOLINE-3,5-DIONE is used in the methods for determining levels of 1,25 dihydroxyvitamin d2 and d3 in biological and food samples and dietary supplements.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |





