A6782812
4-Amino-1-methyl-3-n-propyl-5-pyrazolecarboxamide , 98% , 139756-02-8
Synonym(s):
4-Amino-2-methyl-5-propyl-2H-pyrazole-3-carboxylic acid amide
CAS NO.:139756-02-8
Empirical Formula: C8H14N4O
Molecular Weight: 182.22
MDL number: MFCD02927682
EINECS: 604-160-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB68.80 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| 100g | RMB1172.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-101 °C(lit.) |
| Boiling point: | 325.9±42.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | Solid |
| pka | 15.30±0.50(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C8H14N4O/c1-3-4-5-6(9)7(8(10)13)12(2)11-5/h3-4,9H2,1-2H3,(H2,10,13) |
| InChIKey | PZMXDLWWQHYXGY-UHFFFAOYSA-N |
| SMILES | N1(C)C(C(N)=O)=C(N)C(CCC)=N1 |
| CAS DataBase Reference | 139756-02-8(CAS DataBase Reference) |
Description and Uses
A potent hypolipidemic agent. A possible inhibitor of phosphodiesterase 1
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933.19.4300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![5-(2-Ethoxyphenyl)-1-methyl-3-<I>n</I>-propyl-1,6-dihydro-7<I>H</I>-pyrazolo[4,3-<I>d</I>]-7-pyrimidinone](https://img.chemicalbook.com/CAS/GIF/139756-21-1.gif)


