A8402612
5-(2-Ethoxyphenyl)-1-methyl-3-<I>n</I>-propyl-1,6-dihydro-7<I>H</I>-pyrazolo[4,3-<I>d</I>]-7-pyrimidinone , 97% , 139756-21-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB127.20 | In Stock |
|
| 2G | RMB231.20 | In Stock |
|
| 5g | RMB422.40 | In Stock |
|
| 10G | RMB719.20 | In Stock |
|
| 25g | RMB1646.40 | In Stock |
|
| 100g | RMB4291.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-145 °C(lit.) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.27±0.20(Predicted) |
| color | White to Pale Beige |
| InChI | InChI=1S/C17H20N4O2/c1-4-8-12-14-15(21(3)20-12)17(22)19-16(18-14)11-9-6-7-10-13(11)23-5-2/h6-7,9-10H,4-5,8H2,1-3H3,(H,18,19,22) |
| InChIKey | MXQUEDUMKWBYHI-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2OCC)NC(=O)C2N(C)N=C(CCC)C=2N=1 |
| CAS DataBase Reference | 139756-21-1 |
Description and Uses
Sildenafil impurity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![5-(2-Ethoxyphenyl)-1-methyl-3-<I>n</I>-propyl-1,6-dihydro-7<I>H</I>-pyrazolo[4,3-<I>d</I>]-7-pyrimidinone](https://img.chemicalbook.com/CAS/GIF/139756-21-1.gif)



![5-(2-Ethoxy-5-(piperazin-1-ylsulfonyl)phenyl)-1-methyl-3-propyl-1H-pyrazolo[4,3-d]pyrimidin-7(6H)-one](https://img.chemicalbook.com/CAS/GIF/139755-82-1.gif)
![5-(2-Ethoxy-5-((4-(2-hydroxyethyl)piperazin-1-yl)sulfonyl)phenyl)-1-methyl-3-propyl-1H-pyrazolo[4,3-d]pyrimidin-7(6H)-one](https://img.chemicalbook.com/CAS/GIF/139755-85-4.gif)
