A6807412
Papain from Carica papaya Latex(Suspension) , ≥20UNITS/MGProtein, with baee as a substrate , 9001-73-4
Synonym(s):
cystein protease;papain;Papain powder;Papainase
CAS NO.:9001-73-4
Empirical Formula: C9H14N4O3
Molecular Weight: 226.232
MDL number: MFCD00131791
EINECS: 232-627-2
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB447.20 | In Stock |
|
| 100MG | RMB1279.20 | In Stock |
|
| 500MG | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| bulk density | 800kg/m3 |
| Flash point: | 29 °C |
| storage temp. | 2-8°C |
| solubility | H2O: soluble1.2mg/mL |
| form | lyophilized powder |
| color | almost white |
| PH | 4-7 (25°C, 1g/L in H2O) |
| biological source | papaya (latex) |
| Water Solubility | Soluble in water, insoluble in most organic solvents. |
| Merck | 7016 |
| Specific Activity | 30U/mg ~30units/mg protein ( at 25 °C with BAEE as the substrate.) |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(NC(=O)CCN)CC1NC=NC=1 |
| EPA Substance Registry System | Papain (9001-73-4) |
Description and Uses
For tenderizing meats; for clearing beverages; for bating skins.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H334 |
| Precautionary statements | P261-P284-P304+P340-P342+P311-P501 |
| Hazard Codes | Xn |
| Risk Statements | 42/43-42-36/37/38-20/21/22-10 |
| Safety Statements | 36-36/37-26-24-22-45-23-36/37/39 |
| WGK Germany | 3 |
| RTECS | RU4950000 |
| TSCA | Yes |
| HS Code | 35079090 |
| Toxicity | TDLo orl-man: 71 mg/kg:GIT JCGADC 9,127,87 |


