A6810412
Pranoprofen , ≥99% , 52549-17-4
Synonym(s):
2-(5H-[1]-Benzopyrano[2,3-b]pyridin-7-yl)propionic acid;2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid;a-Methyl-5H-[1]benzopyrano[2,3-b]pyridine-7-acetic acid
CAS NO.：52549-17-4
Empirical Formula: C15H13NO3
Molecular Weight: 255.27
MDL number: MFCD00866111
EINECS: 682-035-7
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB128.00 | In Stock |
|
| 250mg | RMB151.20 | In Stock |
|
| 1G | RMB364.80 | In Stock |
|
| 5G | RMB1240.00 | In Stock |
|
| 25g | RMB4319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-183° |
| Boiling point: | 398.5°C (rough estimate) |
| Density | 1.1654 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.27±0.10(Predicted) |
| form | powder |
| color | white to beige |
| InChI | InChI=1S/C15H13NO3/c1-9(15(17)18)10-4-5-13-12(7-10)8-11-3-2-6-16-14(11)19-13/h2-7,9H,8H2,1H3,(H,17,18) |
| InChIKey | TVQZAMVBTVNYLA-UHFFFAOYSA-N |
| SMILES | C(C1C=CC2OC3=NC=CC=C3CC=2C=1)(C)C(=O)O |
| CAS DataBase Reference | 52549-17-4(CAS DataBase Reference) |
Description and Uses
Pranoprofen is an anti-inflammatory used in ophthalmology.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310+P330 |
| RIDADR | UN 2811 6.1 / PGIII |
| RTECS | DJ3100950 |
| Toxicity | LD50 in male mice, rats (mg/kg): 447.3, 87.3 orally (Edanaga) |
