A6811312
Probucol , ≥98% , 23288-49-5
Synonym(s):
Probucol
CAS NO.:23288-49-5
Empirical Formula: C31H48O2S2
Molecular Weight: 516.84
MDL number: MFCD00079281
EINECS: 245-560-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB124.00 | In Stock |
|
| 25G | RMB317.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128°C |
| Boiling point: | 571.58°C (rough estimate) |
| Density | 1.0008 (rough estimate) |
| refractive index | 1.5341 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 10.27±0.70(Predicted) |
| color | White to Off-White |
| Merck | 14,7755 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C31H48O2S2/c1-27(2,3)21-15-19(16-22(25(21)32)28(4,5)6)34-31(13,14)35-20-17-23(29(7,8)9)26(33)24(18-20)30(10,11)12/h15-18,32-33H,1-14H3 |
| InChIKey | FYPMFJGVHOHGLL-UHFFFAOYSA-N |
| SMILES | C(SC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1)(SC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1)(C)C |
| CAS DataBase Reference | 23288-49-5(CAS DataBase Reference) |
Description and Uses
Probucol is an antilipemic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | AL3705000 |
| HS Code | 2930902000 |
| Storage Class | 11 - Combustible Solids |







